|
Abstract
|
Uracil and its derivatives, such as pyrimido[4,5-b]quinolines have received considerable attention over the past years because of their have biological activities such as, antibacterial, antiallergic, antimicrobial, tyrosine kinase, anti-inflammatory, analgesic, calcium channel antagonists, antihypertensive, tuberculostatic, antileishmanial, and antifungal [1-3]. In this work, nano magnetic particles of Fe3O4@SiO2(CH2)N(CH2PO3H2)2 as a novel and heterogeneous catalyst containing of phosphorous acid groups was synthesized and fully characterized by using various analysis techniques including. A good range of novel pyrimido[4,5-b]quinolines were prepared in the presence of Fe3O4@SiO2(CH2)N(CH2PO3H2)2 under solvent-free condition (Scheme 1). Also, structure of desired products pyrimido[4,5-b]quinolones were fully characterized by using various analysis techniques such as 1H-NMR, 13C-NMR, mass spectrum, fourier transform infrared spectroscopy (FT-IR).
|